C12H23NO2 — CID 42310250
3-[cyclohexyl(methyl)azaniumyl]-2,2-dimethylpropanoate (PubChem CID 42310250) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[cyclohexyl(methyl)azaniumyl]-2,2-dimethylpropanoate.
| Compound Name | 3-[cyclohexyl(methyl)azaniumyl]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 42310250 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-[cyclohexyl(methyl)azaniumyl]-2,2-dimethylpropanoate |
| SMILES | C[NH+](CC(C)(C)C(=O)[O-])C1CCCCC1 |
| InChI | InChI=1S/C12H23NO2/c1-12(2,11(14)15)9-13(3)10-7-5-4-6-8-10/h10H,4-9H2,1-3H3,(H,14,15) |
| InChIKey | GDKRYSLYURJBRF-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 44.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |