C4H8O2S2 — CID 42627076
(2S,3R)-2,3-bis(sulfanylmethyl)oxiran-2-ol (PubChem CID 42627076) has the molecular formula C4H8O2S2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (2S,3R)-2,3-bis(sulfanylmethyl)oxiran-2-ol.
| Compound Name | (2S,3R)-2,3-bis(sulfanylmethyl)oxiran-2-ol |
|---|---|
| PubChem CID | 42627076 |
| Molecular Formula | C4H8O2S2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.00 |
| IUPAC Name | (2S,3R)-2,3-bis(sulfanylmethyl)oxiran-2-ol |
| SMILES | O[C@]1(CS)O[C@H]1CS |
| InChI | InChI=1S/C4H8O2S2/c5-4(2-8)3(1-7)6-4/h3,5,7-8H,1-2H2/t3-,4+/m0/s1 |
| InChIKey | ROADAVWLDIEXBM-IUYQGCFVSA-N |
| XLogP | -0.07 |
| TPSA | 32.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|