C27H41N3O3 — CID 42665499
2-[butyl(furan-2-ylmethyl)amino]-5-(octanoylamino)-N-propylbenzamide (PubChem CID 42665499) has the molecular formula C27H41N3O3 and a molecular weight of 455.64 g/mol. Its IUPAC name is 2-[butyl(furan-2-ylmethyl)amino]-5-(octanoylamino)-N-propylbenzamide.
| Compound Name | 2-[butyl(furan-2-ylmethyl)amino]-5-(octanoylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 42665499 |
| Molecular Formula | C27H41N3O3 |
| Molecular Weight | 455.64 g/mol |
| Exact Mass | 455.31 |
| IUPAC Name | 2-[butyl(furan-2-ylmethyl)amino]-5-(octanoylamino)-N-propylbenzamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(N(CCCC)Cc2ccco2)c(C(=O)NCCC)c1 |
| InChI | InChI=1S/C27H41N3O3/c1-4-7-9-10-11-14-26(31)29-22-15-16-25(24(20-22)27(32)28-17-6-3)30(18-8-5-2)21-23-13-12-19-33-23/h12-13,15-16,19-20H,4-11,14,17-18,21H2,1-3H3,(H,28,32)(H,29,31) |
| InChIKey | GMRAHBBVEIMJHU-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.64 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|