C26H38N4O3 — CID 42781999
2-[butyl(furan-2-ylmethyl)amino]-5-(cyclohexylcarbamoylamino)-N-propylbenzamide (PubChem CID 42781999) has the molecular formula C26H38N4O3 and a molecular weight of 454.62 g/mol. Its IUPAC name is 2-[butyl(furan-2-ylmethyl)amino]-5-(cyclohexylcarbamoylamino)-N-propylbenzamide.
| Compound Name | 2-[butyl(furan-2-ylmethyl)amino]-5-(cyclohexylcarbamoylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 42781999 |
| Molecular Formula | C26H38N4O3 |
| Molecular Weight | 454.62 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | 2-[butyl(furan-2-ylmethyl)amino]-5-(cyclohexylcarbamoylamino)-N-propylbenzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)NC2CCCCC2)cc1C(=O)NCCC |
| InChI | InChI=1S/C26H38N4O3/c1-3-5-16-30(19-22-12-9-17-33-22)24-14-13-21(18-23(24)25(31)27-15-4-2)29-26(32)28-20-10-7-6-8-11-20/h9,12-14,17-18,20H,3-8,10-11,15-16,19H2,1-2H3,(H,27,31)(H2,28,29,32) |
| InChIKey | XEUKIEUXULKQIH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|