C26H30FN3O3 — CID 3296802
2-[butyl(furan-2-ylmethyl)amino]-5-[(2-fluorobenzoyl)amino]-N-propylbenzamide (PubChem CID 3296802) has the molecular formula C26H30FN3O3 and a molecular weight of 451.54 g/mol. Its IUPAC name is 2-[butyl(furan-2-ylmethyl)amino]-5-[(2-fluorobenzoyl)amino]-N-propylbenzamide.
| Compound Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(2-fluorobenzoyl)amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 3296802 |
| Molecular Formula | C26H30FN3O3 |
| Molecular Weight | 451.54 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(2-fluorobenzoyl)amino]-N-propylbenzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)c2ccccc2F)cc1C(=O)NCCC |
| InChI | InChI=1S/C26H30FN3O3/c1-3-5-15-30(18-20-9-8-16-33-20)24-13-12-19(17-22(24)25(31)28-14-4-2)29-26(32)21-10-6-7-11-23(21)27/h6-13,16-17H,3-5,14-15,18H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | NLLGZAOOPPDAHM-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.54 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|