C21H27Cl2N3O3 — CID 4316600
2-[butyl(furan-2-ylmethyl)amino]-5-[(2,2-dichloroacetyl)amino]-N-propylbenzamide (PubChem CID 4316600) has the molecular formula C21H27Cl2N3O3 and a molecular weight of 440.37 g/mol. Its IUPAC name is 2-[butyl(furan-2-ylmethyl)amino]-5-[(2,2-dichloroacetyl)amino]-N-propylbenzamide.
| Compound Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(2,2-dichloroacetyl)amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 4316600 |
| Molecular Formula | C21H27Cl2N3O3 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(2,2-dichloroacetyl)amino]-N-propylbenzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)C(Cl)Cl)cc1C(=O)NCCC |
| InChI | InChI=1S/C21H27Cl2N3O3/c1-3-5-11-26(14-16-7-6-12-29-16)18-9-8-15(25-21(28)19(22)23)13-17(18)20(27)24-10-4-2/h6-9,12-13,19H,3-5,10-11,14H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | OFVTUVROHGJGAO-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|