C25H35N3O3 — CID 7212901
N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]pentanamide (PubChem CID 7212901) has the molecular formula C25H35N3O3 and a molecular weight of 425.57 g/mol. Its IUPAC name is N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]pentanamide.
| Compound Name | N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]pentanamide |
|---|---|
| PubChem CID | 7212901 |
| Molecular Formula | C25H35N3O3 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.27 |
| IUPAC Name | N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]pentanamide |
| SMILES | CCCCC(=O)Nc1ccc(N(CCCC)Cc2ccco2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C25H35N3O3/c1-3-5-11-24(29)26-20-12-13-23(22(18-20)25(30)27-15-7-8-16-27)28(14-6-4-2)19-21-10-9-17-31-21/h9-10,12-13,17-18H,3-8,11,14-16,19H2,1-2H3,(H,26,29) |
| InChIKey | PGBXIPFLDOLQOX-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|