C34H46N4O3 — CID 3438761
1-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]urea (PubChem CID 3438761) has the molecular formula C34H46N4O3 and a molecular weight of 558.77 g/mol. Its IUPAC name is 1-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]urea.
| Compound Name | 1-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
|---|---|
| PubChem CID | 3438761 |
| Molecular Formula | C34H46N4O3 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.36 |
| IUPAC Name | 1-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]-3-[2,6-di(propan-2-yl)phenyl]urea |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)Nc2c(C(C)C)cccc2C(C)C)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C34H46N4O3/c1-6-7-18-38(23-27-13-12-21-41-27)31-17-16-26(22-30(31)33(39)37-19-9-8-10-20-37)35-34(40)36-32-28(24(2)3)14-11-15-29(32)25(4)5/h11-17,21-22,24-25H,6-10,18-20,23H2,1-5H3,(H2,35,36,40) |
| InChIKey | ZHYAUGKNQZWHMB-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|