C28H32BrN3O3 — CID 42781928
3-bromo-N-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 42781928) has the molecular formula C28H32BrN3O3 and a molecular weight of 538.49 g/mol. Its IUPAC name is 3-bromo-N-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 3-bromo-N-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 42781928 |
| Molecular Formula | C28H32BrN3O3 |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 537.16 |
| IUPAC Name | 3-bromo-N-[4-[butyl(furan-2-ylmethyl)amino]-3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)c2cccc(Br)c2)cc1C(=O)N1CCCCC1 |
| InChI | InChI=1S/C28H32BrN3O3/c1-2-3-14-32(20-24-11-8-17-35-24)26-13-12-23(30-27(33)21-9-7-10-22(29)18-21)19-25(26)28(34)31-15-5-4-6-16-31/h7-13,17-19H,2-6,14-16,20H2,1H3,(H,30,33) |
| InChIKey | RLNFVNRPZBFDEP-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|