C27H29Cl2N3O3 — CID 42781945
N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide (PubChem CID 42781945) has the molecular formula C27H29Cl2N3O3 and a molecular weight of 514.45 g/mol. Its IUPAC name is N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide.
| Compound Name | N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 42781945 |
| Molecular Formula | C27H29Cl2N3O3 |
| Molecular Weight | 514.45 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-2,4-dichlorobenzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)c2ccc(Cl)cc2Cl)cc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C27H29Cl2N3O3/c1-2-3-12-32(18-21-7-6-15-35-21)25-11-9-20(17-23(25)27(34)31-13-4-5-14-31)30-26(33)22-10-8-19(28)16-24(22)29/h6-11,15-17H,2-5,12-14,18H2,1H3,(H,30,33) |
| InChIKey | LYSNKBUCMCFFBF-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.45 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|