C26H31ClN4O3 — CID 4244122
2-[butyl(furan-2-ylmethyl)amino]-5-[(3-chlorophenyl)carbamoylamino]-N-propylbenzamide (PubChem CID 4244122) has the molecular formula C26H31ClN4O3 and a molecular weight of 483.01 g/mol. Its IUPAC name is 2-[butyl(furan-2-ylmethyl)amino]-5-[(3-chlorophenyl)carbamoylamino]-N-propylbenzamide.
| Compound Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(3-chlorophenyl)carbamoylamino]-N-propylbenzamide |
|---|---|
| PubChem CID | 4244122 |
| Molecular Formula | C26H31ClN4O3 |
| Molecular Weight | 483.01 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(3-chlorophenyl)carbamoylamino]-N-propylbenzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)Nc2cccc(Cl)c2)cc1C(=O)NCCC |
| InChI | InChI=1S/C26H31ClN4O3/c1-3-5-14-31(18-22-10-7-15-34-22)24-12-11-21(17-23(24)25(32)28-13-4-2)30-26(33)29-20-9-6-8-19(27)16-20/h6-12,15-17H,3-5,13-14,18H2,1-2H3,(H,28,32)(H2,29,30,33) |
| InChIKey | LZBJWPKBVIDSQF-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.01 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|