C27H32ClN3O3 — CID 5026708
2-[butyl(furan-2-ylmethyl)amino]-5-[(2-chloro-2-phenylacetyl)amino]-N-propylbenzamide (PubChem CID 5026708) has the molecular formula C27H32ClN3O3 and a molecular weight of 482.02 g/mol. Its IUPAC name is 2-[butyl(furan-2-ylmethyl)amino]-5-[(2-chloro-2-phenylacetyl)amino]-N-propylbenzamide.
| Compound Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(2-chloro-2-phenylacetyl)amino]-N-propylbenzamide |
|---|---|
| PubChem CID | 5026708 |
| Molecular Formula | C27H32ClN3O3 |
| Molecular Weight | 482.02 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 2-[butyl(furan-2-ylmethyl)amino]-5-[(2-chloro-2-phenylacetyl)amino]-N-propylbenzamide |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)C(Cl)c2ccccc2)cc1C(=O)NCCC |
| InChI | InChI=1S/C27H32ClN3O3/c1-3-5-16-31(19-22-12-9-17-34-22)24-14-13-21(18-23(24)26(32)29-15-4-2)30-27(33)25(28)20-10-7-6-8-11-20/h6-14,17-18,25H,3-5,15-16,19H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | PPJZLNVZRRDYNT-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.02 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|