C28H41N3O3 — CID 42781947
N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]octanamide (PubChem CID 42781947) has the molecular formula C28H41N3O3 and a molecular weight of 467.65 g/mol. Its IUPAC name is N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]octanamide.
| Compound Name | N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]octanamide |
|---|---|
| PubChem CID | 42781947 |
| Molecular Formula | C28H41N3O3 |
| Molecular Weight | 467.65 g/mol |
| Exact Mass | 467.31 |
| IUPAC Name | N-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]octanamide |
| SMILES | CCCCCCCC(=O)Nc1ccc(N(CCCC)Cc2ccco2)c(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C28H41N3O3/c1-3-5-7-8-9-14-27(32)29-23-15-16-26(25(21-23)28(33)30-18-10-11-19-30)31(17-6-4-2)22-24-13-12-20-34-24/h12-13,15-16,20-21H,3-11,14,17-19,22H2,1-2H3,(H,29,32) |
| InChIKey | YRKOYDNQSKZQBW-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 65.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.65 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|