C27H30Cl2N4O3 — CID 4652215
1-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2,4-dichlorophenyl)urea (PubChem CID 4652215) has the molecular formula C27H30Cl2N4O3 and a molecular weight of 529.47 g/mol. Its IUPAC name is 1-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2,4-dichlorophenyl)urea.
| Compound Name | 1-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 4652215 |
| Molecular Formula | C27H30Cl2N4O3 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.17 |
| IUPAC Name | 1-[4-[butyl(furan-2-ylmethyl)amino]-3-(pyrrolidine-1-carbonyl)phenyl]-3-(2,4-dichlorophenyl)urea |
| SMILES | CCCCN(Cc1ccco1)c1ccc(NC(=O)Nc2ccc(Cl)cc2Cl)cc1C(=O)N1CCCC1 |
| InChI | InChI=1S/C27H30Cl2N4O3/c1-2-3-12-33(18-21-7-6-15-36-21)25-11-9-20(17-22(25)26(34)32-13-4-5-14-32)30-27(35)31-24-10-8-19(28)16-23(24)29/h6-11,15-17H,2-5,12-14,18H2,1H3,(H2,30,31,35) |
| InChIKey | ZYEXPVXCLMOUJF-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|