C30H29ClN4O2S — CID 42771824
6-[4-[(2-chlorobenzoyl)amino]phenyl]-N-(2,4-dimethylphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 42771824) has the molecular formula C30H29ClN4O2S and a molecular weight of 545.11 g/mol. Its IUPAC name is 6-[4-[(2-chlorobenzoyl)amino]phenyl]-N-(2,4-dimethylphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | 6-[4-[(2-chlorobenzoyl)amino]phenyl]-N-(2,4-dimethylphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 42771824 |
| Molecular Formula | C30H29ClN4O2S |
| Molecular Weight | 545.11 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 6-[4-[(2-chlorobenzoyl)amino]phenyl]-N-(2,4-dimethylphenyl)-8-methyl-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(NC(=O)c3ccccc3Cl)cc2)N2CCCSC2=N1 |
| InChI | InChI=1S/C30H29ClN4O2S/c1-18-9-14-25(19(2)17-18)34-29(37)26-20(3)32-30-35(15-6-16-38-30)27(26)21-10-12-22(13-11-21)33-28(36)23-7-4-5-8-24(23)31/h4-5,7-14,17,27H,6,15-16H2,1-3H3,(H,33,36)(H,34,37) |
| InChIKey | UJMUTGHKPCIQNZ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.11 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |