C34H32N4O2S — CID 4659741
N-(2,4-dimethylphenyl)-8-methyl-6-[4-(naphthalene-1-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide (PubChem CID 4659741) has the molecular formula C34H32N4O2S and a molecular weight of 560.72 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-8-methyl-6-[4-(naphthalene-1-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-8-methyl-6-[4-(naphthalene-1-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
|---|---|
| PubChem CID | 4659741 |
| Molecular Formula | C34H32N4O2S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | N-(2,4-dimethylphenyl)-8-methyl-6-[4-(naphthalene-1-carbonylamino)phenyl]-2,3,4,6-tetrahydropyrimido[2,1-b][1,3]thiazine-7-carboxamide |
| SMILES | CC1=C(C(=O)Nc2ccc(C)cc2C)C(c2ccc(NC(=O)c3cccc4ccccc34)cc2)N2CCCSC2=N1 |
| InChI | InChI=1S/C34H32N4O2S/c1-21-12-17-29(22(2)20-21)37-33(40)30-23(3)35-34-38(18-7-19-41-34)31(30)25-13-15-26(16-14-25)36-32(39)28-11-6-9-24-8-4-5-10-27(24)28/h4-6,8-17,20,31H,7,18-19H2,1-3H3,(H,36,39)(H,37,40) |
| InChIKey | UIRFTBNZCJSAAK-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |