C28H36N4O3 — CID 42803518
ethyl 4-[3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate (PubChem CID 42803518) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is ethyl 4-[3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 42803518 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | ethyl 4-[3-(2-phenylethyl)-1,2,4,4a,5,6-hexahydropyrazino[1,2-a]quinoline-5-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)C2Cc3ccccc3N3CCN(CCc4ccccc4)CC23)CC1 |
| InChI | InChI=1S/C28H36N4O3/c1-2-35-28(34)31-17-15-30(16-18-31)27(33)24-20-23-10-6-7-11-25(23)32-19-14-29(21-26(24)32)13-12-22-8-4-3-5-9-22/h3-11,24,26H,2,12-21H2,1H3 |
| InChIKey | GAOVCXFEKOKNAN-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 56.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |