C26H26N4O4S2 — CID 42915303
1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]thiourea (PubChem CID 42915303) has the molecular formula C26H26N4O4S2 and a molecular weight of 522.65 g/mol. Its IUPAC name is 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]thiourea.
| Compound Name | 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 42915303 |
| Molecular Formula | C26H26N4O4S2 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.14 |
| IUPAC Name | 1-(4-morpholin-4-ylsulfonylphenyl)-3-[(E)-(2-phenyl-2,3-dihydrochromen-4-ylidene)amino]thiourea |
| SMILES | O=S(=O)(c1ccc(NC(=S)N/N=C2\CC(c3ccccc3)Oc3ccccc32)cc1)N1CCOCC1 |
| InChI | InChI=1S/C26H26N4O4S2/c31-36(32,30-14-16-33-17-15-30)21-12-10-20(11-13-21)27-26(35)29-28-23-18-25(19-6-2-1-3-7-19)34-24-9-5-4-8-22(23)24/h1-13,25H,14-18H2,(H2,27,29,35)/b28-23+ |
| InChIKey | DEDSNFHSSMTZBM-WEMUOSSPSA-N |
| XLogP | 3.92 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|