C19H20ClF3N4O3 — CID 42938329
N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide (PubChem CID 42938329) has the molecular formula C19H20ClF3N4O3 and a molecular weight of 444.84 g/mol. Its IUPAC name is N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide.
| Compound Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42938329 |
| Molecular Formula | C19H20ClF3N4O3 |
| Molecular Weight | 444.84 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | N-[2-[[3-chloro-5-(trifluoromethyl)-2-pyridinyl]amino]ethyl]-1-(furan-2-carbonyl)piperidine-3-carboxamide |
| SMILES | O=C(NCCNc1ncc(C(F)(F)F)cc1Cl)C1CCCN(C(=O)c2ccco2)C1 |
| InChI | InChI=1S/C19H20ClF3N4O3/c20-14-9-13(19(21,22)23)10-26-16(14)24-5-6-25-17(28)12-3-1-7-27(11-12)18(29)15-4-2-8-30-15/h2,4,8-10,12H,1,3,5-7,11H2,(H,24,26)(H,25,28) |
| InChIKey | UMBCPJGPGMIUOC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.84 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|