C22H28BrN3O3 — CID 43012267
2-[2-bromo-6-ethoxy-4-[(E)-[ethyl-(4-methylphenyl)hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide (PubChem CID 43012267) has the molecular formula C22H28BrN3O3 and a molecular weight of 462.39 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-[(E)-[ethyl-(4-methylphenyl)hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-[(E)-[ethyl-(4-methylphenyl)hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 43012267 |
| Molecular Formula | C22H28BrN3O3 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-[(E)-[ethyl-(4-methylphenyl)hydrazinylidene]methyl]phenoxy]-N,N-dimethylacetamide |
| SMILES | CCOc1cc(/C=N/N(CC)c2ccc(C)cc2)cc(Br)c1OCC(=O)N(C)C |
| InChI | InChI=1S/C22H28BrN3O3/c1-6-26(18-10-8-16(3)9-11-18)24-14-17-12-19(23)22(20(13-17)28-7-2)29-15-21(27)25(4)5/h8-14H,6-7,15H2,1-5H3/b24-14+ |
| InChIKey | IDZWDUYBEIHOCI-ZVHZXABRSA-N |
| XLogP | 4.48 |
| TPSA | 54.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|