C27H37ClN4O6S — CID 44523546
1-[5-(1,4-diazepan-1-ylsulfonyl)isoquinolin-1-yl]oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol;hydrochloride (PubChem CID 44523546) has the molecular formula C27H37ClN4O6S and a molecular weight of 581.14 g/mol. Its IUPAC name is 1-[5-(1,4-diazepan-1-ylsulfonyl)isoquinolin-1-yl]oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol;hydrochloride.
| Compound Name | 1-[5-(1,4-diazepan-1-ylsulfonyl)isoquinolin-1-yl]oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 44523546 |
| Molecular Formula | C27H37ClN4O6S |
| Molecular Weight | 581.14 g/mol |
| Exact Mass | 580.21 |
| IUPAC Name | 1-[5-(1,4-diazepan-1-ylsulfonyl)isoquinolin-1-yl]oxy-3-[2-(3,4-dimethoxyphenyl)ethylamino]propan-2-ol;hydrochloride |
| SMILES | COc1ccc(CCNCC(O)COc2nccc3c(S(=O)(=O)N4CCCNCC4)cccc23)cc1OC.Cl |
| InChI | InChI=1S/C27H36N4O6S.ClH/c1-35-24-8-7-20(17-25(24)36-2)9-12-29-18-21(32)19-37-27-23-5-3-6-26(22(23)10-13-30-27)38(33,34)31-15-4-11-28-14-16-31;/h3,5-8,10,13,17,21,28-29,32H,4,9,11-12,14-16,18-19H2,1-2H3;1H |
| InChIKey | TUYORSCSPVROSR-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 122.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.14 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|