C25H29ClN4O4 — CID 44529654
1-[1-[3-(7-chloroquinolin-4-yl)oxypropyl]pyrrolidin-3-yl]-3-(3,4-dimethoxyphenyl)urea (PubChem CID 44529654) has the molecular formula C25H29ClN4O4 and a molecular weight of 484.98 g/mol. Its IUPAC name is 1-[1-[3-(7-chloroquinolin-4-yl)oxypropyl]pyrrolidin-3-yl]-3-(3,4-dimethoxyphenyl)urea.
| Compound Name | 1-[1-[3-(7-chloroquinolin-4-yl)oxypropyl]pyrrolidin-3-yl]-3-(3,4-dimethoxyphenyl)urea |
|---|---|
| PubChem CID | 44529654 |
| Molecular Formula | C25H29ClN4O4 |
| Molecular Weight | 484.98 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | 1-[1-[3-(7-chloroquinolin-4-yl)oxypropyl]pyrrolidin-3-yl]-3-(3,4-dimethoxyphenyl)urea |
| SMILES | COc1ccc(NC(=O)NC2CCN(CCCOc3ccnc4cc(Cl)ccc34)C2)cc1OC |
| InChI | InChI=1S/C25H29ClN4O4/c1-32-23-7-5-18(15-24(23)33-2)28-25(31)29-19-9-12-30(16-19)11-3-13-34-22-8-10-27-21-14-17(26)4-6-20(21)22/h4-8,10,14-15,19H,3,9,11-13,16H2,1-2H3,(H2,28,29,31) |
| InChIKey | DAABLWCJYWKJAG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.98 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|