C27H33N3O — CID 44543307
2-[[(3R,4R)-1-benzyl-4-prop-2-enoxypyrrolidin-3-yl]methyl]-6-(2,5-dimethylpyrrol-1-yl)-4-methylpyridine (PubChem CID 44543307) has the molecular formula C27H33N3O and a molecular weight of 415.58 g/mol. Its IUPAC name is 2-[[(3R,4R)-1-benzyl-4-prop-2-enoxypyrrolidin-3-yl]methyl]-6-(2,5-dimethylpyrrol-1-yl)-4-methylpyridine.
| Compound Name | 2-[[(3R,4R)-1-benzyl-4-prop-2-enoxypyrrolidin-3-yl]methyl]-6-(2,5-dimethylpyrrol-1-yl)-4-methylpyridine |
|---|---|
| PubChem CID | 44543307 |
| Molecular Formula | C27H33N3O |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.26 |
| IUPAC Name | 2-[[(3R,4R)-1-benzyl-4-prop-2-enoxypyrrolidin-3-yl]methyl]-6-(2,5-dimethylpyrrol-1-yl)-4-methylpyridine |
| SMILES | C=CCO[C@H]1CN(Cc2ccccc2)C[C@H]1Cc1cc(C)cc(-n2c(C)ccc2C)n1 |
| InChI | InChI=1S/C27H33N3O/c1-5-13-31-26-19-29(17-23-9-7-6-8-10-23)18-24(26)16-25-14-20(2)15-27(28-25)30-21(3)11-12-22(30)4/h5-12,14-15,24,26H,1,13,16-19H2,2-4H3/t24-,26+/m1/s1 |
| InChIKey | VYCSLWXAFNGLKG-RSXGOPAZSA-N |
| XLogP | 5.04 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|