C32H37FeNO10S2+2 — CID 44550417
CID 44550417 (PubChem CID 44550417) has the molecular formula C32H37FeNO10S2+2 and a molecular weight of 715.62 g/mol.
| Compound Name | CID 44550417 |
|---|---|
| PubChem CID | 44550417 |
| Molecular Formula | C32H37FeNO10S2+2 |
| Molecular Weight | 715.62 g/mol |
| Exact Mass | 715.12 |
| IUPAC Name | — |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SCCC(=O)[C]2[CH][CH][CH][CH]2)[C@H](NS(=O)(=O)c2ccc(C)cc2)[C@@H](OC(C)=O)[C@@H]1OC(C)=O.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C27H32NO10S2.C5H5.Fe/c1-16-9-11-21(12-10-16)40(33,34)28-24-26(37-19(4)31)25(36-18(3)30)23(15-35-17(2)29)38-27(24)39-14-13-22(32)20-7-5-6-8-20;1-2-4-5-3-1;/h5-12,23-28H,13-15H2,1-4H3;1-5H;/q;;+2/t23-,24-,25-,26-,27+;;/m1../s1 |
| InChIKey | ACKAHZATGJIPDH-QPAUFNPFSA-N |
| XLogP | 2.91 |
| TPSA | 151.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.62 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|