C27H40N2O3 — CID 44580694
(1R,4aS,10aR)-1,4a-dimethyl-6-[(2-piperidin-1-ylacetyl)amino]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid (PubChem CID 44580694) has the molecular formula C27H40N2O3 and a molecular weight of 440.63 g/mol. Its IUPAC name is (1R,4aS,10aR)-1,4a-dimethyl-6-[(2-piperidin-1-ylacetyl)amino]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,10aR)-1,4a-dimethyl-6-[(2-piperidin-1-ylacetyl)amino]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 44580694 |
| Molecular Formula | C27H40N2O3 |
| Molecular Weight | 440.63 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (1R,4aS,10aR)-1,4a-dimethyl-6-[(2-piperidin-1-ylacetyl)amino]-7-propan-2-yl-2,3,4,9,10,10a-hexahydrophenanthrene-1-carboxylic acid |
| SMILES | CC(C)c1cc2c(cc1NC(=O)CN1CCCCC1)[C@@]1(C)CCC[C@@](C)(C(=O)O)[C@@H]1CC2 |
| InChI | InChI=1S/C27H40N2O3/c1-18(2)20-15-19-9-10-23-26(3,11-8-12-27(23,4)25(31)32)21(19)16-22(20)28-24(30)17-29-13-6-5-7-14-29/h15-16,18,23H,5-14,17H2,1-4H3,(H,28,30)(H,31,32)/t23-,26-,27-/m1/s1 |
| InChIKey | NNHXFNBHRYWZDJ-XSBVVTFOSA-N |
| XLogP | 5.33 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.63 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |