C17H23ClN2O7 — CID 44582622
(4R)-5-(2-chloroethylamino)-5-oxo-4-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid (PubChem CID 44582622) has the molecular formula C17H23ClN2O7 and a molecular weight of 402.83 g/mol. Its IUPAC name is (4R)-5-(2-chloroethylamino)-5-oxo-4-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid.
| Compound Name | (4R)-5-(2-chloroethylamino)-5-oxo-4-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 44582622 |
| Molecular Formula | C17H23ClN2O7 |
| Molecular Weight | 402.83 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (4R)-5-(2-chloroethylamino)-5-oxo-4-[(3,4,5-trimethoxybenzoyl)amino]pentanoic acid |
| SMILES | COc1cc(C(=O)N[C@H](CCC(=O)O)C(=O)NCCCl)cc(OC)c1OC |
| InChI | InChI=1S/C17H23ClN2O7/c1-25-12-8-10(9-13(26-2)15(12)27-3)16(23)20-11(4-5-14(21)22)17(24)19-7-6-18/h8-9,11H,4-7H2,1-3H3,(H,19,24)(H,20,23)(H,21,22)/t11-/m1/s1 |
| InChIKey | HSLSHFAHKZFSOL-LLVKDONJSA-N |
| XLogP | 1.03 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.83 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|