C25H39NO9S — CID 44655716
(2-cyclohexyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-8-yl)methyl 3,4,5-trimethoxybenzoate;hydrogen sulfate (PubChem CID 44655716) has the molecular formula C25H39NO9S and a molecular weight of 529.65 g/mol. Its IUPAC name is (2-cyclohexyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-8-yl)methyl 3,4,5-trimethoxybenzoate;hydrogen sulfate.
| Compound Name | (2-cyclohexyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-8-yl)methyl 3,4,5-trimethoxybenzoate;hydrogen sulfate |
|---|---|
| PubChem CID | 44655716 |
| Molecular Formula | C25H39NO9S |
| Molecular Weight | 529.65 g/mol |
| Exact Mass | 529.23 |
| IUPAC Name | (2-cyclohexyl-2,3,4,5,6,7,8,8a-octahydro-1H-indolizin-4-ium-8-yl)methyl 3,4,5-trimethoxybenzoate;hydrogen sulfate |
| SMILES | COc1cc(C(=O)OCC2CCC[NH+]3CC(C4CCCCC4)CC23)cc(OC)c1OC.O=S(=O)([O-])O |
| InChI | InChI=1S/C25H37NO5.H2O4S/c1-28-22-13-19(14-23(29-2)24(22)30-3)25(27)31-16-18-10-7-11-26-15-20(12-21(18)26)17-8-5-4-6-9-17;1-5(2,3)4/h13-14,17-18,20-21H,4-12,15-16H2,1-3H3;(H2,1,2,3,4) |
| InChIKey | VSXXZRQYGJHXSM-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 135.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.65 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|