C25H30ClN3O3S — CID 44663901
ethyl 2-[[2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate chloride (PubChem CID 44663901) has the molecular formula C25H30ClN3O3S and a molecular weight of 488.05 g/mol. Its IUPAC name is ethyl 2-[[2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate chloride.
| Compound Name | ethyl 2-[[2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate chloride |
|---|---|
| PubChem CID | 44663901 |
| Molecular Formula | C25H30ClN3O3S |
| Molecular Weight | 488.05 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | ethyl 2-[[2-(3-phenyl-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl)acetyl]amino]-3a,4,5,6,7,7a-hexahydro-1-benzothiophene-3-carboxylate chloride |
| SMILES | CCOC(=O)C1=C(NC(=O)C[n+]2cc(-c3ccccc3)n3c2CCC3)SC2CCCCC12.[Cl-] |
| InChI | InChI=1S/C25H29N3O3S.ClH/c1-2-31-25(30)23-18-11-6-7-12-20(18)32-24(23)26-21(29)16-27-15-19(17-9-4-3-5-10-17)28-14-8-13-22(27)28;/h3-5,9-10,15,18,20H,2,6-8,11-14,16H2,1H3;1H |
| InChIKey | DHIYQDVDOXRWFF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.05 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|