C33H30N8O12 — CID 44815073
[5-[(3S,4S)-3,4-dinitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate (PubChem CID 44815073) has the molecular formula C33H30N8O12 and a molecular weight of 730.65 g/mol. Its IUPAC name is [5-[(3S,4S)-3,4-dinitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate.
| Compound Name | [5-[(3S,4S)-3,4-dinitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 44815073 |
| Molecular Formula | C33H30N8O12 |
| Molecular Weight | 730.65 g/mol |
| Exact Mass | 730.20 |
| IUPAC Name | [5-[(3S,4S)-3,4-dinitrooxypentyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate |
| SMILES | CCOc1nc2ccc(C(=O)OCc3oc(=O)oc3CC[C@H](O[N+](=O)[O-])[C@H](C)O[N+](=O)[O-])cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C33H30N8O12/c1-3-48-32-34-25-13-12-22(31(42)49-18-29-28(50-33(43)51-29)15-14-27(53-41(46)47)19(2)52-40(44)45)16-26(25)39(32)17-20-8-10-21(11-9-20)23-6-4-5-7-24(23)30-35-37-38-36-30/h4-13,16,19,27H,3,14-15,17-18H2,1-2H3,(H,35,36,37,38)/t19-,27-/m0/s1 |
| InChIKey | ZTUFPQNUIAZBGB-PPHZAIPVSA-N |
| XLogP | 4.34 |
| TPSA | 255.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 730.65 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|