C31H27N7O9 — CID 44815238
[5-[(2S)-2-nitrooxypropyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate (PubChem CID 44815238) has the molecular formula C31H27N7O9 and a molecular weight of 641.60 g/mol. Its IUPAC name is [5-[(2S)-2-nitrooxypropyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate.
| Compound Name | [5-[(2S)-2-nitrooxypropyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate |
|---|---|
| PubChem CID | 44815238 |
| Molecular Formula | C31H27N7O9 |
| Molecular Weight | 641.60 g/mol |
| Exact Mass | 641.19 |
| IUPAC Name | [5-[(2S)-2-nitrooxypropyl]-2-oxo-1,3-dioxol-4-yl]methyl 2-ethoxy-3-[[4-[2-(2H-tetrazol-5-yl)phenyl]phenyl]methyl]benzimidazole-5-carboxylate |
| SMILES | CCOc1nc2ccc(C(=O)OCc3oc(=O)oc3C[C@H](C)O[N+](=O)[O-])cc2n1Cc1ccc(-c2ccccc2-c2nn[nH]n2)cc1 |
| InChI | InChI=1S/C31H27N7O9/c1-3-43-30-32-24-13-12-21(29(39)44-17-27-26(45-31(40)46-27)14-18(2)47-38(41)42)15-25(24)37(30)16-19-8-10-20(11-9-19)22-6-4-5-7-23(22)28-33-35-36-34-28/h4-13,15,18H,3,14,16-17H2,1-2H3,(H,33,34,35,36)/t18-/m0/s1 |
| InChIKey | RBOZDLUWIJTRIY-SFHVURJKSA-N |
| XLogP | 4.37 |
| TPSA | 203.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.60 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|