C23H29N3O2S2 — CID 45112001
(9Z)-1,3,4,5,6,7,8-heptadeuterio-N,N-dimethyl-9-[2,2,3,3-tetradeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propylidene]thioxanthene-2-sulfonamide (PubChem CID 45112001) has the molecular formula C23H29N3O2S2 and a molecular weight of 462.75 g/mol. Its IUPAC name is (9Z)-1,3,4,5,6,7,8-heptadeuterio-N,N-dimethyl-9-[2,2,3,3-tetradeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propylidene]thioxanthene-2-sulfonamide.
| Compound Name | (9Z)-1,3,4,5,6,7,8-heptadeuterio-N,N-dimethyl-9-[2,2,3,3-tetradeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propylidene]thioxanthene-2-sulfonamide |
|---|---|
| PubChem CID | 45112001 |
| Molecular Formula | C23H29N3O2S2 |
| Molecular Weight | 462.75 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | (9Z)-1,3,4,5,6,7,8-heptadeuterio-N,N-dimethyl-9-[2,2,3,3-tetradeuterio-3-(2,2,3,3,5,5,6,6-octadeuterio-4-methylpiperazin-1-yl)propylidene]thioxanthene-2-sulfonamide |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])Sc1c([2H])c([2H])c(S(=O)(=O)N(C)C)c([2H])c1/C2=C\C([2H])([2H])C([2H])([2H])N1C([2H])([2H])C([2H])([2H])N(C)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C23H29N3O2S2/c1-24(2)30(27,28)18-10-11-23-21(17-18)19(20-7-4-5-9-22(20)29-23)8-6-12-26-15-13-25(3)14-16-26/h4-5,7-11,17H,6,12-16H2,1-3H3/b19-8-/i4D,5D,6D2,7D,9D,10D,11D,12D2,13D2,14D2,15D2,16D2,17D |
| InChIKey | GFBKORZTTCHDGY-UDJCFQQJSA-N |
| XLogP | 3.47 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.75 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'} |
|---|