C26H28BrClN2O — CID 45132355
2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide (PubChem CID 45132355) has the molecular formula C26H28BrClN2O and a molecular weight of 499.88 g/mol. Its IUPAC name is 2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide.
| Compound Name | 2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide |
|---|---|
| PubChem CID | 45132355 |
| Molecular Formula | C26H28BrClN2O |
| Molecular Weight | 499.88 g/mol |
| Exact Mass | 498.11 |
| IUPAC Name | 2-[3-(4-chlorophenyl)-6,7,8,9-tetrahydro-5H-imidazo[1,2-a]azepin-1-ium-1-yl]-1-(5,6,7,8-tetrahydronaphthalen-2-yl)ethanone bromide |
| SMILES | O=C(C[n+]1cc(-c2ccc(Cl)cc2)n2c1CCCCC2)c1ccc2c(c1)CCCC2.[Br-] |
| InChI | InChI=1S/C26H28ClN2O.BrH/c27-23-13-11-20(12-14-23)24-17-28(26-8-2-1-5-15-29(24)26)18-25(30)22-10-9-19-6-3-4-7-21(19)16-22;/h9-14,16-17H,1-8,15,18H2;1H/q+1;/p-1 |
| InChIKey | NCHDMFVHWDNWOW-UHFFFAOYSA-M |
| XLogP | 2.59 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.88 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|