C25H27F3N4O5 — CID 46182510
(2S)-2-methyl-6-nitro-2-[[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]phenoxy]methyl]-7,7a-dihydro-3H-imidazo[2,1-b][1,3]oxazole (PubChem CID 46182510) has the molecular formula C25H27F3N4O5 and a molecular weight of 520.51 g/mol. Its IUPAC name is (2S)-2-methyl-6-nitro-2-[[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]phenoxy]methyl]-7,7a-dihydro-3H-imidazo[2,1-b][1,3]oxazole.
| Compound Name | (2S)-2-methyl-6-nitro-2-[[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]phenoxy]methyl]-7,7a-dihydro-3H-imidazo[2,1-b][1,3]oxazole |
|---|---|
| PubChem CID | 46182510 |
| Molecular Formula | C25H27F3N4O5 |
| Molecular Weight | 520.51 g/mol |
| Exact Mass | 520.19 |
| IUPAC Name | (2S)-2-methyl-6-nitro-2-[[4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]phenoxy]methyl]-7,7a-dihydro-3H-imidazo[2,1-b][1,3]oxazole |
| SMILES | C[C@@]1(COc2ccc(N3CCC(Oc4ccc(C(F)(F)F)cc4)CC3)cc2)CN2C=C([N+](=O)[O-])NC2O1 |
| InChI | InChI=1S/C25H27F3N4O5/c1-24(15-31-14-22(32(33)34)29-23(31)37-24)16-35-19-8-4-18(5-9-19)30-12-10-21(11-13-30)36-20-6-2-17(3-7-20)25(26,27)28/h2-9,14,21,23,29H,10-13,15-16H2,1H3/t23?,24-/m0/s1 |
| InChIKey | JACLFRYFGAAXKF-CGAIIQECSA-N |
| XLogP | 4.19 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|