C17H14N4O2S — CID 4619168
3-methyl-N-[3-(2-nitrophenyl)prop-2-enylideneamino]-1,3-benzothiazol-2-imine (PubChem CID 4619168) has the molecular formula C17H14N4O2S and a molecular weight of 338.39 g/mol. Its IUPAC name is 3-methyl-N-[3-(2-nitrophenyl)prop-2-enylideneamino]-1,3-benzothiazol-2-imine.
| Compound Name | 3-methyl-N-[3-(2-nitrophenyl)prop-2-enylideneamino]-1,3-benzothiazol-2-imine |
|---|---|
| PubChem CID | 4619168 |
| Molecular Formula | C17H14N4O2S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.08 |
| IUPAC Name | 3-methyl-N-[3-(2-nitrophenyl)prop-2-enylideneamino]-1,3-benzothiazol-2-imine |
| SMILES | Cn1c(=NN=CC=Cc2ccccc2[N+](=O)[O-])sc2ccccc21 |
| InChI | InChI=1S/C17H14N4O2S/c1-20-15-10-4-5-11-16(15)24-17(20)19-18-12-6-8-13-7-2-3-9-14(13)21(22)23/h2-12H,1H3 |
| InChIKey | JUFWHDGNWISKDL-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 72.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_imine_B(3)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|