C8H17NO9P2 — CID 46197779
(2S)-2-amino-4-[(1-carboxy-3-phosphonopropan-2-yl)-hydroxyphosphoryl]butanoic acid (PubChem CID 46197779) has the molecular formula C8H17NO9P2 and a molecular weight of 333.17 g/mol. Its IUPAC name is (2S)-2-amino-4-[(1-carboxy-3-phosphonopropan-2-yl)-hydroxyphosphoryl]butanoic acid.
| Compound Name | (2S)-2-amino-4-[(1-carboxy-3-phosphonopropan-2-yl)-hydroxyphosphoryl]butanoic acid |
|---|---|
| PubChem CID | 46197779 |
| Molecular Formula | C8H17NO9P2 |
| Molecular Weight | 333.17 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (2S)-2-amino-4-[(1-carboxy-3-phosphonopropan-2-yl)-hydroxyphosphoryl]butanoic acid |
| SMILES | N[C@@H](CCP(=O)(O)C(CC(=O)O)CP(=O)(O)O)C(=O)O |
| InChI | InChI=1S/C8H17NO9P2/c9-6(8(12)13)1-2-19(14,15)5(3-7(10)11)4-20(16,17)18/h5-6H,1-4,9H2,(H,10,11)(H,12,13)(H,14,15)(H2,16,17,18)/t5?,6-/m0/s1 |
| InChIKey | OTYXWVKEWNCHHC-GDVGLLTNSA-N |
| XLogP | -0.92 |
| TPSA | 195.45 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.17 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|