C24H44O9Si — CID 46237118
dimethyl (2S)-2-[(6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,8-dimethyl-3-oxodecanoyl]oxybutanedioate (PubChem CID 46237118) has the molecular formula C24H44O9Si and a molecular weight of 504.69 g/mol. Its IUPAC name is dimethyl (2S)-2-[(6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,8-dimethyl-3-oxodecanoyl]oxybutanedioate.
| Compound Name | dimethyl (2S)-2-[(6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,8-dimethyl-3-oxodecanoyl]oxybutanedioate |
|---|---|
| PubChem CID | 46237118 |
| Molecular Formula | C24H44O9Si |
| Molecular Weight | 504.69 g/mol |
| Exact Mass | 504.28 |
| IUPAC Name | dimethyl (2S)-2-[(6S,8S)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-6,8-dimethyl-3-oxodecanoyl]oxybutanedioate |
| SMILES | CC[C@H](C)C[C@](C)(O[Si](C)(C)C(C)(C)C)C(O)CC(=O)CC(=O)O[C@@H](CC(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H44O9Si/c1-11-16(2)15-24(6,33-34(9,10)23(3,4)5)19(26)12-17(25)13-21(28)32-18(22(29)31-8)14-20(27)30-7/h16,18-19,26H,11-15H2,1-10H3/t16-,18-,19?,24-/m0/s1 |
| InChIKey | PJDVGHZJTFMSTF-LENFNMTISA-N |
| XLogP | 3.56 |
| TPSA | 125.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.69 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|