C17H18F3N3O4S — CID 46519793
N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 46519793) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 46519793 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | N-[(1,3-dimethyl-2,6-dioxopyrimidin-4-yl)methyl]-N-prop-2-enyl-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | C=CCN(Cc1cc(=O)n(C)c(=O)n1C)S(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3O4S/c1-4-8-23(11-13-10-15(24)22(3)16(25)21(13)2)28(26,27)14-7-5-6-12(9-14)17(18,19)20/h4-7,9-10H,1,8,11H2,2-3H3 |
| InChIKey | LVHFDJQXCJERBJ-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|