C19H20O6S — CID 46677348
(1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 2,5-dimethoxybenzenesulfonate (PubChem CID 46677348) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 2,5-dimethoxybenzenesulfonate.
| Compound Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 2,5-dimethoxybenzenesulfonate |
|---|---|
| PubChem CID | 46677348 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | (1,7-dimethyl-3-oxo-1,2-dihydroinden-4-yl) 2,5-dimethoxybenzenesulfonate |
| SMILES | COc1ccc(OC)c(S(=O)(=O)Oc2ccc(C)c3c2C(=O)CC3C)c1 |
| InChI | InChI=1S/C19H20O6S/c1-11-5-7-16(19-14(20)9-12(2)18(11)19)25-26(21,22)17-10-13(23-3)6-8-15(17)24-4/h5-8,10,12H,9H2,1-4H3 |
| InChIKey | FSHJUQYIWUMTFM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|