C15H11N3O8 — CID 46784544
1-[(2,4-dinitroanilino)methyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione (PubChem CID 46784544) has the molecular formula C15H11N3O8 and a molecular weight of 361.27 g/mol. Its IUPAC name is 1-[(2,4-dinitroanilino)methyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione.
| Compound Name | 1-[(2,4-dinitroanilino)methyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
|---|---|
| PubChem CID | 46784544 |
| Molecular Formula | C15H11N3O8 |
| Molecular Weight | 361.27 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 1-[(2,4-dinitroanilino)methyl]-4,10-dioxatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione |
| SMILES | O=C1OC(=O)C2C1C1C=CC2(CNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])O1 |
| InChI | InChI=1S/C15H11N3O8/c19-13-11-10-3-4-15(26-10,12(11)14(20)25-13)6-16-8-2-1-7(17(21)22)5-9(8)18(23)24/h1-5,10-12,16H,6H2 |
| InChIKey | ITKWPRMSUXKSRO-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 150.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|