C23H38N4O8 — CID 46834144
bis(3-methylbutyl) 2-[[2-[[2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]acetyl]amino]acetyl]amino]propanedioate (PubChem CID 46834144) has the molecular formula C23H38N4O8 and a molecular weight of 498.58 g/mol. Its IUPAC name is bis(3-methylbutyl) 2-[[2-[[2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]acetyl]amino]acetyl]amino]propanedioate.
| Compound Name | bis(3-methylbutyl) 2-[[2-[[2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]acetyl]amino]acetyl]amino]propanedioate |
|---|---|
| PubChem CID | 46834144 |
| Molecular Formula | C23H38N4O8 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | bis(3-methylbutyl) 2-[[2-[[2-[[2-(2-methylprop-2-enoylamino)acetyl]amino]acetyl]amino]acetyl]amino]propanedioate |
| SMILES | C=C(C)C(=O)NCC(=O)NCC(=O)NCC(=O)NC(C(=O)OCCC(C)C)C(=O)OCCC(C)C |
| InChI | InChI=1S/C23H38N4O8/c1-14(2)7-9-34-22(32)20(23(33)35-10-8-15(3)4)27-19(30)13-25-17(28)11-24-18(29)12-26-21(31)16(5)6/h14-15,20H,5,7-13H2,1-4,6H3,(H,24,29)(H,25,28)(H,26,31)(H,27,30) |
| InChIKey | RMPAUINHCDRZCM-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|