C36H31ClN4O5S2 — CID 46842674
4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-(3-nitrophenyl)sulfonyl-2-phenylsulfanylbenzamide (PubChem CID 46842674) has the molecular formula C36H31ClN4O5S2 and a molecular weight of 699.25 g/mol. Its IUPAC name is 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-(3-nitrophenyl)sulfonyl-2-phenylsulfanylbenzamide.
| Compound Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-(3-nitrophenyl)sulfonyl-2-phenylsulfanylbenzamide |
|---|---|
| PubChem CID | 46842674 |
| Molecular Formula | C36H31ClN4O5S2 |
| Molecular Weight | 699.25 g/mol |
| Exact Mass | 698.14 |
| IUPAC Name | 4-[4-[[2-(4-chlorophenyl)phenyl]methyl]piperazin-1-yl]-N-(3-nitrophenyl)sulfonyl-2-phenylsulfanylbenzamide |
| SMILES | O=C(NS(=O)(=O)c1cccc([N+](=O)[O-])c1)c1ccc(N2CCN(Cc3ccccc3-c3ccc(Cl)cc3)CC2)cc1Sc1ccccc1 |
| InChI | InChI=1S/C36H31ClN4O5S2/c37-28-15-13-26(14-16-28)33-12-5-4-7-27(33)25-39-19-21-40(22-20-39)29-17-18-34(35(24-29)47-31-9-2-1-3-10-31)36(42)38-48(45,46)32-11-6-8-30(23-32)41(43)44/h1-18,23-24H,19-22,25H2,(H,38,42) |
| InChIKey | KOJIENBSLDFNMM-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.25 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|