C10H20F6N3P — CID 46844372
1,3-dibutyltriazol-1-ium hexafluorophosphate (PubChem CID 46844372) has the molecular formula C10H20F6N3P and a molecular weight of 327.25 g/mol. Its IUPAC name is 1,3-dibutyltriazol-1-ium hexafluorophosphate.
| Compound Name | 1,3-dibutyltriazol-1-ium hexafluorophosphate |
|---|---|
| PubChem CID | 46844372 |
| Molecular Formula | C10H20F6N3P |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 1,3-dibutyltriazol-1-ium hexafluorophosphate |
| SMILES | CCCCn1cc[n+](CCCC)n1.F[P-](F)(F)(F)(F)F |
| InChI | InChI=1S/C10H20N3.F6P/c1-3-5-7-12-9-10-13(11-12)8-6-4-2;1-7(2,3,4,5)6/h9-10H,3-8H2,1-2H3;/q+1;-1 |
| InChIKey | OXLNMLBHEDGLRZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|