C16H12N4O6 — CID 5042080
N'-(2,4-dinitrophenyl)-2-prop-2-ynoxybenzohydrazide (PubChem CID 5042080) has the molecular formula C16H12N4O6 and a molecular weight of 356.29 g/mol. Its IUPAC name is N'-(2,4-dinitrophenyl)-2-prop-2-ynoxybenzohydrazide.
| Compound Name | N'-(2,4-dinitrophenyl)-2-prop-2-ynoxybenzohydrazide |
|---|---|
| PubChem CID | 5042080 |
| Molecular Formula | C16H12N4O6 |
| Molecular Weight | 356.29 g/mol |
| Exact Mass | 356.08 |
| IUPAC Name | N'-(2,4-dinitrophenyl)-2-prop-2-ynoxybenzohydrazide |
| SMILES | C#CCOc1ccccc1C(=O)NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N4O6/c1-2-9-26-15-6-4-3-5-12(15)16(21)18-17-13-8-7-11(19(22)23)10-14(13)20(24)25/h1,3-8,10,17H,9H2,(H,18,21) |
| InChIKey | HKNLHFLYDTXCNO-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.29 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|