C36H51NO5S2 — CID 5047797
N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide (PubChem CID 5047797) has the molecular formula C36H51NO5S2 and a molecular weight of 641.94 g/mol. Its IUPAC name is N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide.
| Compound Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 5047797 |
| Molecular Formula | C36H51NO5S2 |
| Molecular Weight | 641.94 g/mol |
| Exact Mass | 641.32 |
| IUPAC Name | N-[[17-(cyclohexanecarbonyl)-5,13-dihydroxy-6,10-dimethyl-5-tricyclo[13.2.2.02,6]nonadeca-1(17),9,15,18-tetraenyl]methyl]-N-propylthiophene-2-sulfonamide |
| SMILES | CCCN(CC1(O)CCC2c3ccc(cc3C(=O)C3CCCCC3)CC(O)CCC(C)=CCCC21C)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C36H51NO5S2/c1-4-21-37(44(41,42)33-13-9-22-43-33)25-36(40)20-18-32-30-17-15-27(24-31(30)34(39)28-11-6-5-7-12-28)23-29(38)16-14-26(2)10-8-19-35(32,36)3/h9-10,13,15,17,22,24,28-29,32,38,40H,4-8,11-12,14,16,18-21,23,25H2,1-3H3 |
| InChIKey | KXULHOXSQCZGCD-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.94 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|