C35H27N5O7S — CID 5066502
5-[[4-[1-(3-carboxypropyl)-6-iminopyridazin-3-yl]phenyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 5066502) has the molecular formula C35H27N5O7S and a molecular weight of 661.70 g/mol. Its IUPAC name is 5-[[4-[1-(3-carboxypropyl)-6-iminopyridazin-3-yl]phenyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-[[4-[1-(3-carboxypropyl)-6-iminopyridazin-3-yl]phenyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 5066502 |
| Molecular Formula | C35H27N5O7S |
| Molecular Weight | 661.70 g/mol |
| Exact Mass | 661.16 |
| IUPAC Name | 5-[[4-[1-(3-carboxypropyl)-6-iminopyridazin-3-yl]phenyl]carbamothioylamino]-2-(3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | [H]/N=c1\ccc(-c2ccc(NC(=S)Nc3ccc(-c4c5ccc(=O)cc-5oc5cc(O)ccc45)c(C(=O)O)c3)cc2)nn1CCCC(=O)O |
| InChI | InChI=1S/C35H27N5O7S/c36-31-14-13-28(39-40(31)15-1-2-32(43)44)19-3-5-20(6-4-19)37-35(48)38-21-7-10-24(27(16-21)34(45)46)33-25-11-8-22(41)17-29(25)47-30-18-23(42)9-12-26(30)33/h3-14,16-18,36,41H,1-2,15H2,(H,43,44)(H,45,46)(H2,37,38,48)/b36-31+ |
| InChIKey | VQGZBFDZKLNWFW-XKMRCYARSA-N |
| XLogP | 5.99 |
| TPSA | 190.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.70 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|