C9H19O11P3 — CID 50914615
[(E)-4-hydroxybut-2-enyl] [hydroxy-[hydroxy(2-methylbut-3-enoxy)phosphoryl]oxyphosphoryl] hydrogen phosphate (PubChem CID 50914615) has the molecular formula C9H19O11P3 and a molecular weight of 396.16 g/mol. Its IUPAC name is [(E)-4-hydroxybut-2-enyl] [hydroxy-[hydroxy(2-methylbut-3-enoxy)phosphoryl]oxyphosphoryl] hydrogen phosphate.
| Compound Name | [(E)-4-hydroxybut-2-enyl] [hydroxy-[hydroxy(2-methylbut-3-enoxy)phosphoryl]oxyphosphoryl] hydrogen phosphate |
|---|---|
| PubChem CID | 50914615 |
| Molecular Formula | C9H19O11P3 |
| Molecular Weight | 396.16 g/mol |
| Exact Mass | 396.01 |
| IUPAC Name | [(E)-4-hydroxybut-2-enyl] [hydroxy-[hydroxy(2-methylbut-3-enoxy)phosphoryl]oxyphosphoryl] hydrogen phosphate |
| SMILES | C=CC(C)COP(=O)(O)OP(=O)(O)OP(=O)(O)OC/C=C/CO |
| InChI | InChI=1S/C9H19O11P3/c1-3-9(2)8-18-22(13,14)20-23(15,16)19-21(11,12)17-7-5-4-6-10/h3-5,9-10H,1,6-8H2,2H3,(H,11,12)(H,13,14)(H,15,16)/b5-4+ |
| InChIKey | KIEJAIBNWSKLBH-SNAWJCMRSA-N |
| XLogP | 1.72 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.16 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|