C26H44N7O6PS — CID 52937796
[(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate;bis(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine) (PubChem CID 52937796) has the molecular formula C26H44N7O6PS and a molecular weight of 613.72 g/mol. Its IUPAC name is [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate;bis(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine).
| Compound Name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate;bis(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine) |
|---|---|
| PubChem CID | 52937796 |
| Molecular Formula | C26H44N7O6PS |
| Molecular Weight | 613.72 g/mol |
| Exact Mass | 613.28 |
| IUPAC Name | [(2R,5S)-5-(4-amino-2-oxopyrimidin-1-yl)-1,3-oxathiolan-2-yl]methyl dihydrogen phosphate;bis(2,3,4,6,7,8,9,10-octahydropyrimido[1,2-a]azepine) |
| SMILES | C1CCC2=NCCCN2CC1.C1CCC2=NCCCN2CC1.Nc1ccn([C@@H]2CS[C@H](COP(=O)(O)O)O2)c(=O)n1 |
| InChI | InChI=1S/2C9H16N2.C8H12N3O6PS/c2*1-2-5-9-10-6-4-8-11(9)7-3-1;9-5-1-2-11(8(12)10-5)6-4-19-7(17-6)3-16-18(13,14)15/h2*1-8H2;1-2,6-7H,3-4H2,(H2,9,10,12)(H2,13,14,15)/t;;6-,7+/m..0/s1 |
| InChIKey | FVYCEUWVQPGSSR-XIUWGNCSSA-N |
| XLogP | 2.85 |
| TPSA | 168.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.72 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|