C20H26O2S — CID 531731
2-(1-adamantyl)ethyl 2-phenylsulfanylacetate (PubChem CID 531731) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is 2-(1-adamantyl)ethyl 2-phenylsulfanylacetate.
| Compound Name | 2-(1-adamantyl)ethyl 2-phenylsulfanylacetate |
|---|---|
| PubChem CID | 531731 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 2-(1-adamantyl)ethyl 2-phenylsulfanylacetate |
| SMILES | O=C(CSc1ccccc1)OCCC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H26O2S/c21-19(14-23-18-4-2-1-3-5-18)22-7-6-20-11-15-8-16(12-20)10-17(9-15)13-20/h1-5,15-17H,6-14H2 |
| InChIKey | MVJMRHGNZUBBPJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |