C19H20ClN5O2S — CID 53181810
1-(4-chlorophenyl)sulfonyl-4-(5-pyridin-2-yl-1H-pyrazol-3-yl)-1,4-diazepane (PubChem CID 53181810) has the molecular formula C19H20ClN5O2S and a molecular weight of 417.92 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-4-(5-pyridin-2-yl-1H-pyrazol-3-yl)-1,4-diazepane.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-4-(5-pyridin-2-yl-1H-pyrazol-3-yl)-1,4-diazepane |
|---|---|
| PubChem CID | 53181810 |
| Molecular Formula | C19H20ClN5O2S |
| Molecular Weight | 417.92 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-4-(5-pyridin-2-yl-1H-pyrazol-3-yl)-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc(Cl)cc1)N1CCCN(c2cc(-c3ccccn3)[nH]n2)CC1 |
| InChI | InChI=1S/C19H20ClN5O2S/c20-15-5-7-16(8-6-15)28(26,27)25-11-3-10-24(12-13-25)19-14-18(22-23-19)17-4-1-2-9-21-17/h1-2,4-9,14H,3,10-13H2,(H,22,23) |
| InChIKey | KPCRIDONUCDACZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |