C10H18N2O4S — CID 53436185
butylcarbamoyl 2-acetamido-3-sulfanylpropanoate (PubChem CID 53436185) has the molecular formula C10H18N2O4S and a molecular weight of 262.33 g/mol. Its IUPAC name is butylcarbamoyl 2-acetamido-3-sulfanylpropanoate.
| Compound Name | butylcarbamoyl 2-acetamido-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 53436185 |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | butylcarbamoyl 2-acetamido-3-sulfanylpropanoate |
| SMILES | CCCCNC(=O)OC(=O)C(CS)NC(C)=O |
| InChI | InChI=1S/C10H18N2O4S/c1-3-4-5-11-10(15)16-9(14)8(6-17)12-7(2)13/h8,17H,3-6H2,1-2H3,(H,11,15)(H,12,13) |
| InChIKey | GPPFVQSUVOVHJD-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|